C13H23IO4 — CID 15042006
tert-butyl 2-[(4R,6S)-6-(iodomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (PubChem CID 15042006) has the molecular formula C13H23IO4 and a molecular weight of 370.23 g/mol. Its IUPAC name is tert-butyl 2-[(4R,6S)-6-(iodomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate.
| Compound Name | tert-butyl 2-[(4R,6S)-6-(iodomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 15042006 |
| Molecular Formula | C13H23IO4 |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | tert-butyl 2-[(4R,6S)-6-(iodomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@H]1C[C@@H](CI)OC(C)(C)O1 |
| InChI | InChI=1S/C13H23IO4/c1-12(2,3)18-11(15)7-9-6-10(8-14)17-13(4,5)16-9/h9-10H,6-8H2,1-5H3/t9-,10+/m1/s1 |
| InChIKey | CORVBPCRXWGOBJ-ZJUUUORDSA-N |
| XLogP | 3.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|