About 6-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide
6-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 15042089) has the molecular formula C8H8N4O
and a molecular weight of 176.18 g/mol. Its IUPAC name is 6-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide.
Molecular Properties
| Compound Name | 6-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
| PubChem CID | 15042089 |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 6-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | Cc1cnc2c(C(N)=O)cnn2c1 |
| InChI | InChI=1S/C8H8N4O/c1-5-2-10-8-6(7(9)13)3-11-12(8)4-5/h2-4H,1H3,(H2,9,13) |
| InChIKey | ZSJDYGZWDYMLDS-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 73.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide?
The IUPAC name of 6-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide (CID 15042089) is 6-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide.
What is the SMILES notation for 6-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide?
The canonical SMILES for 6-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide is Cc1cnc2c(C(N)=O)cnn2c1.
What is the InChIKey of 6-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide?
The InChIKey is ZSJDYGZWDYMLDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O/c1-5-2-10-8-6(7(9)13)3-11-12(8)4-5/h2-4H,1H3,(H2,9,13).
What are the key properties of 6-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide?
6-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide has a molecular weight of 176.18 g/mol, XLogP of 0.14, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide is sourced from PubChem (CID 15042089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).