C15H18FN3O2 — CID 15042139
N-cyano-N'-[(3S,4R)-6-fluoro-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]propanimidamide (PubChem CID 15042139) has the molecular formula C15H18FN3O2 and a molecular weight of 291.33 g/mol. Its IUPAC name is N-cyano-N'-[(3S,4R)-6-fluoro-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]propanimidamide.
| Compound Name | N-cyano-N'-[(3S,4R)-6-fluoro-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]propanimidamide |
|---|---|
| PubChem CID | 15042139 |
| Molecular Formula | C15H18FN3O2 |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | N-cyano-N'-[(3S,4R)-6-fluoro-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]propanimidamide |
| SMILES | CC/C(=N\[C@@H]1c2cc(F)ccc2OC(C)(C)[C@H]1O)NC#N |
| InChI | InChI=1S/C15H18FN3O2/c1-4-12(18-8-17)19-13-10-7-9(16)5-6-11(10)21-15(2,3)14(13)20/h5-7,13-14,20H,4H2,1-3H3,(H,18,19)/t13-,14+/m1/s1 |
| InChIKey | AWFDFBOWFIGOMW-KGLIPLIRSA-N |
| XLogP | 2.28 |
| TPSA | 77.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|