C21H13F6O5- — CID 150421612
2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-4-[(4-hydroxy-2-oxochromen-3-yl)methyl]benzoate (PubChem CID 150421612) has the molecular formula C21H13F6O5- and a molecular weight of 459.32 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-4-[(4-hydroxy-2-oxochromen-3-yl)methyl]benzoate.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-4-[(4-hydroxy-2-oxochromen-3-yl)methyl]benzoate |
|---|---|
| PubChem CID | 150421612 |
| Molecular Formula | C21H13F6O5- |
| Molecular Weight | 459.32 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-4-[(4-hydroxy-2-oxochromen-3-yl)methyl]benzoate |
| SMILES | CC(c1cc(Cc2c(O)c3ccccc3oc2=O)ccc1C(=O)[O-])(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H14F6O5/c1-19(20(22,23)24,21(25,26)27)14-9-10(6-7-11(14)17(29)30)8-13-16(28)12-4-2-3-5-15(12)32-18(13)31/h2-7,9,28H,8H2,1H3,(H,29,30)/p-1 |
| InChIKey | HHXFSIFZLGJUCL-UHFFFAOYSA-M |
| XLogP | 3.84 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|