C15H31NO2 — CID 15042536
(2S,3R,4S)-2-amino-1-cyclohexyl-7-methyloctane-3,4-diol (PubChem CID 15042536) has the molecular formula C15H31NO2 and a molecular weight of 257.42 g/mol. Its IUPAC name is (2S,3R,4S)-2-amino-1-cyclohexyl-7-methyloctane-3,4-diol.
| Compound Name | (2S,3R,4S)-2-amino-1-cyclohexyl-7-methyloctane-3,4-diol |
|---|---|
| PubChem CID | 15042536 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | (2S,3R,4S)-2-amino-1-cyclohexyl-7-methyloctane-3,4-diol |
| SMILES | CC(C)CC[C@H](O)[C@H](O)[C@@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C15H31NO2/c1-11(2)8-9-14(17)15(18)13(16)10-12-6-4-3-5-7-12/h11-15,17-18H,3-10,16H2,1-2H3/t13-,14-,15+/m0/s1 |
| InChIKey | HQLYPJUDLQZXRG-SOUVJXGZSA-N |
| XLogP | 2.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |