C17H31NO4 — CID 15042544
tert-butyl N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxyhex-5-en-2-yl]carbamate (PubChem CID 15042544) has the molecular formula C17H31NO4 and a molecular weight of 313.44 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxyhex-5-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxyhex-5-en-2-yl]carbamate |
|---|---|
| PubChem CID | 15042544 |
| Molecular Formula | C17H31NO4 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | tert-butyl N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxyhex-5-en-2-yl]carbamate |
| SMILES | C=C[C@H](O)[C@H](O)[C@H](CC1CCCCC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H31NO4/c1-5-14(19)15(20)13(11-12-9-7-6-8-10-12)18-16(21)22-17(2,3)4/h5,12-15,19-20H,1,6-11H2,2-4H3,(H,18,21)/t13-,14-,15+/m0/s1 |
| InChIKey | MKVUJOZXCPXVGB-SOUVJXGZSA-N |
| XLogP | 2.76 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|