C12H23NO2 — CID 15042545
(3S,4R,5S)-5-amino-6-cyclohexylhex-1-ene-3,4-diol (PubChem CID 15042545) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is (3S,4R,5S)-5-amino-6-cyclohexylhex-1-ene-3,4-diol.
| Compound Name | (3S,4R,5S)-5-amino-6-cyclohexylhex-1-ene-3,4-diol |
|---|---|
| PubChem CID | 15042545 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | (3S,4R,5S)-5-amino-6-cyclohexylhex-1-ene-3,4-diol |
| SMILES | C=C[C@H](O)[C@H](O)[C@@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C12H23NO2/c1-2-11(14)12(15)10(13)8-9-6-4-3-5-7-9/h2,9-12,14-15H,1,3-8,13H2/t10-,11-,12+/m0/s1 |
| InChIKey | JLOQCKNDISFIAL-SDDRHHMPSA-N |
| XLogP | 1.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|