C14H21N2O2P — CID 150425759
1H-indol-2-ylmethyl-N-pentan-3-ylphosphonamidic acid (PubChem CID 150425759) has the molecular formula C14H21N2O2P and a molecular weight of 280.31 g/mol. Its IUPAC name is 1H-indol-2-ylmethyl-N-pentan-3-ylphosphonamidic acid.
| Compound Name | 1H-indol-2-ylmethyl-N-pentan-3-ylphosphonamidic acid |
|---|---|
| PubChem CID | 150425759 |
| Molecular Formula | C14H21N2O2P |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 1H-indol-2-ylmethyl-N-pentan-3-ylphosphonamidic acid |
| SMILES | CCC(CC)NP(=O)(O)Cc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H21N2O2P/c1-3-12(4-2)16-19(17,18)10-13-9-11-7-5-6-8-14(11)15-13/h5-9,12,15H,3-4,10H2,1-2H3,(H2,16,17,18) |
| InChIKey | HISHYVVDRFVWQN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|