C22H43N3O7SSi2 — CID 150426350
[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(4-carbamoylimidazol-1-yl)oxolan-2-yl]methyl methanesulfonate (PubChem CID 150426350) has the molecular formula C22H43N3O7SSi2 and a molecular weight of 549.84 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(4-carbamoylimidazol-1-yl)oxolan-2-yl]methyl methanesulfonate.
| Compound Name | [(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(4-carbamoylimidazol-1-yl)oxolan-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 150426350 |
| Molecular Formula | C22H43N3O7SSi2 |
| Molecular Weight | 549.84 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(4-carbamoylimidazol-1-yl)oxolan-2-yl]methyl methanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COS(C)(=O)=O)O[C@H]1n1cnc(C(N)=O)c1 |
| InChI | InChI=1S/C22H43N3O7SSi2/c1-21(2,3)34(8,9)31-17-16(13-29-33(7,27)28)30-20(25-12-15(19(23)26)24-14-25)18(17)32-35(10,11)22(4,5)6/h12,14,16-18,20H,13H2,1-11H3,(H2,23,26)/t16-,17-,18-,20-/m1/s1 |
| InChIKey | HIVMLHRDNLMYGX-SOAMZJECSA-N |
| XLogP | 3.64 |
| TPSA | 131.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.84 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|