C47H56N6O7 — CID 150427016
1,5-dicyclohexyl-2,4-bis[2-(3,4,5-trimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]pentan-3-one (PubChem CID 150427016) has the molecular formula C47H56N6O7 and a molecular weight of 817.00 g/mol. Its IUPAC name is 1,5-dicyclohexyl-2,4-bis[2-(3,4,5-trimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]pentan-3-one.
| Compound Name | 1,5-dicyclohexyl-2,4-bis[2-(3,4,5-trimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]pentan-3-one |
|---|---|
| PubChem CID | 150427016 |
| Molecular Formula | C47H56N6O7 |
| Molecular Weight | 817.00 g/mol |
| Exact Mass | 816.42 |
| IUPAC Name | 1,5-dicyclohexyl-2,4-bis[2-(3,4,5-trimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]pentan-3-one |
| SMILES | COc1cc(-c2cnc3[nH]cc(C(CC4CCCCC4)C(=O)C(CC4CCCCC4)c4c[nH]c5ncc(-c6cc(OC)c(OC)c(OC)c6)nc45)c3n2)cc(OC)c1OC |
| InChI | InChI=1S/C47H56N6O7/c1-55-37-19-29(20-38(56-2)44(37)59-5)35-25-50-46-41(52-35)33(23-48-46)31(17-27-13-9-7-10-14-27)43(54)32(18-28-15-11-8-12-16-28)34-24-49-47-42(34)53-36(26-51-47)30-21-39(57-3)45(60-6)40(22-30)58-4/h19-28,31-32H,7-18H2,1-6H3,(H,48,50)(H,49,51) |
| InChIKey | HIYYOMQTDHOWLZ-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 155.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.00 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |