About 5-amino-3-[4-(2,5-difluorophenoxy)phenyl]-1-piperidin-3-ylpyrazole-4-carbonitrile
5-amino-3-[4-(2,5-difluorophenoxy)phenyl]-1-piperidin-3-ylpyrazole-4-carbonitrile (PubChem CID 150429322) has the molecular formula C21H19F2N5O
and a molecular weight of 395.41 g/mol. Its IUPAC name is 5-amino-3-[4-(2,5-difluorophenoxy)phenyl]-1-piperidin-3-ylpyrazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-amino-3-[4-(2,5-difluorophenoxy)phenyl]-1-piperidin-3-ylpyrazole-4-carbonitrile |
| PubChem CID | 150429322 |
| Molecular Formula | C21H19F2N5O |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 5-amino-3-[4-(2,5-difluorophenoxy)phenyl]-1-piperidin-3-ylpyrazole-4-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(Oc3cc(F)ccc3F)cc2)nn(C2CCCNC2)c1N |
| InChI | InChI=1S/C21H19F2N5O/c22-14-5-8-18(23)19(10-14)29-16-6-3-13(4-7-16)20-17(11-24)21(25)28(27-20)15-2-1-9-26-12-15/h3-8,10,15,26H,1-2,9,12,25H2 |
| InChIKey | HJLKERNWACDXDW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-amino-3-[4-(2,5-difluorophenoxy)phenyl]-1-piperidin-3-ylpyrazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3-[4-(2,5-difluorophenoxy)phenyl]-1-piperidin-3-ylpyrazole-4-carbonitrile?
The IUPAC name of 5-amino-3-[4-(2,5-difluorophenoxy)phenyl]-1-piperidin-3-ylpyrazole-4-carbonitrile (CID 150429322) is 5-amino-3-[4-(2,5-difluorophenoxy)phenyl]-1-piperidin-3-ylpyrazole-4-carbonitrile.
What is the SMILES notation for 5-amino-3-[4-(2,5-difluorophenoxy)phenyl]-1-piperidin-3-ylpyrazole-4-carbonitrile?
The canonical SMILES for 5-amino-3-[4-(2,5-difluorophenoxy)phenyl]-1-piperidin-3-ylpyrazole-4-carbonitrile is N#Cc1c(-c2ccc(Oc3cc(F)ccc3F)cc2)nn(C2CCCNC2)c1N.
What is the InChIKey of 5-amino-3-[4-(2,5-difluorophenoxy)phenyl]-1-piperidin-3-ylpyrazole-4-carbonitrile?
The InChIKey is HJLKERNWACDXDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19F2N5O/c22-14-5-8-18(23)19(10-14)29-16-6-3-13(4-7-16)20-17(11-24)21(25)28(27-20)15-2-1-9-26-12-15/h3-8,10,15,26H,1-2,9,12,25H2.
What are the key properties of 5-amino-3-[4-(2,5-difluorophenoxy)phenyl]-1-piperidin-3-ylpyrazole-4-carbonitrile?
5-amino-3-[4-(2,5-difluorophenoxy)phenyl]-1-piperidin-3-ylpyrazole-4-carbonitrile has a molecular weight of 395.41 g/mol, XLogP of 4.00, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3-[4-(2,5-difluorophenoxy)phenyl]-1-piperidin-3-ylpyrazole-4-carbonitrile is sourced from PubChem (CID 150429322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).