C33H38N5O5PSSi — CID 150430277
2-[(3S,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxo-4-[2-(tetrazol-1-yl)acetyl]sulfanylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetic acid (PubChem CID 150430277) has the molecular formula C33H38N5O5PSSi and a molecular weight of 675.82 g/mol. Its IUPAC name is 2-[(3S,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxo-4-[2-(tetrazol-1-yl)acetyl]sulfanylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetic acid.
| Compound Name | 2-[(3S,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxo-4-[2-(tetrazol-1-yl)acetyl]sulfanylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetic acid |
|---|---|
| PubChem CID | 150430277 |
| Molecular Formula | C33H38N5O5PSSi |
| Molecular Weight | 675.82 g/mol |
| Exact Mass | 675.21 |
| IUPAC Name | 2-[(3S,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxo-4-[2-(tetrazol-1-yl)acetyl]sulfanylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1C(=O)N(C(C(=O)O)=P(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H]1SC(=O)Cn1cnnn1 |
| InChI | InChI=1S/C33H38N5O5PSSi/c1-33(2,3)46(4,5)43-22-27-29(40)38(31(27)45-28(39)21-37-23-34-35-36-37)30(32(41)42)44(24-15-9-6-10-16-24,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-20,23,27,31H,21-22H2,1-5H3,(H,41,42)/t27-,31+/m0/s1 |
| InChIKey | HJQFIKIGAQCDJT-JTSJOTPCSA-N |
| XLogP | 3.95 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.82 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|