C16H11Cl4NO2 — CID 15043807
2,6-dichloro-4-(3,4-dichlorophenyl)-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 15043807) has the molecular formula C16H11Cl4NO2 and a molecular weight of 391.08 g/mol. Its IUPAC name is 2,6-dichloro-4-(3,4-dichlorophenyl)-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | 2,6-dichloro-4-(3,4-dichlorophenyl)-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 15043807 |
| Molecular Formula | C16H11Cl4NO2 |
| Molecular Weight | 391.08 g/mol |
| Exact Mass | 388.95 |
| IUPAC Name | 2,6-dichloro-4-(3,4-dichlorophenyl)-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | O=C1N(c2ccc(Cl)c(Cl)c2)C(=O)C2(Cl)C3C=CC(CC3)C12Cl |
| InChI | InChI=1S/C16H11Cl4NO2/c17-11-6-5-10(7-12(11)18)21-13(22)15(19)8-1-2-9(4-3-8)16(15,20)14(21)23/h1-2,5-9H,3-4H2 |
| InChIKey | BOVAKJBJXLNIFO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.08 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|