C26H23Cl3N2O6S — CID 150439226
2,2,2-trichloroethyl (6R)-3-methyl-8-oxo-7-[(3-oxo-2-phenyl-3-phenylmethoxypropanoyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 150439226) has the molecular formula C26H23Cl3N2O6S and a molecular weight of 597.90 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (6R)-3-methyl-8-oxo-7-[(3-oxo-2-phenyl-3-phenylmethoxypropanoyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (6R)-3-methyl-8-oxo-7-[(3-oxo-2-phenyl-3-phenylmethoxypropanoyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 150439226 |
| Molecular Formula | C26H23Cl3N2O6S |
| Molecular Weight | 597.90 g/mol |
| Exact Mass | 596.03 |
| IUPAC Name | 2,2,2-trichloroethyl (6R)-3-methyl-8-oxo-7-[(3-oxo-2-phenyl-3-phenylmethoxypropanoyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC1=C(C(=O)OCC(Cl)(Cl)Cl)N2C(=O)C(NC(=O)C(C(=O)OCc3ccccc3)c3ccccc3)[C@H]2SC1 |
| InChI | InChI=1S/C26H23Cl3N2O6S/c1-15-13-38-23-19(22(33)31(23)20(15)25(35)37-14-26(27,28)29)30-21(32)18(17-10-6-3-7-11-17)24(34)36-12-16-8-4-2-5-9-16/h2-11,18-19,23H,12-14H2,1H3,(H,30,32)/t18?,19?,23-/m1/s1 |
| InChIKey | HLKKOQNWXMLCFE-MTNXOHHFSA-N |
| XLogP | 4.10 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.90 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|