About 9-amino-7-methoxy-3,4-dihydro-2H-acridin-1-one
9-amino-7-methoxy-3,4-dihydro-2H-acridin-1-one (PubChem CID 15043979) has the molecular formula C14H14N2O2
and a molecular weight of 242.28 g/mol. Its IUPAC name is 9-amino-7-methoxy-3,4-dihydro-2H-acridin-1-one.
Molecular Properties
| Compound Name | 9-amino-7-methoxy-3,4-dihydro-2H-acridin-1-one |
| PubChem CID | 15043979 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 9-amino-7-methoxy-3,4-dihydro-2H-acridin-1-one |
| SMILES | COc1ccc2nc3c(c(N)c2c1)C(=O)CCC3 |
| InChI | InChI=1S/C14H14N2O2/c1-18-8-5-6-10-9(7-8)14(15)13-11(16-10)3-2-4-12(13)17/h5-7H,2-4H2,1H3,(H2,15,16) |
| InChIKey | UMCAERASQBVGHC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-amino-7-methoxy-3,4-dihydro-2H-acridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-amino-7-methoxy-3,4-dihydro-2H-acridin-1-one?
The IUPAC name of 9-amino-7-methoxy-3,4-dihydro-2H-acridin-1-one (CID 15043979) is 9-amino-7-methoxy-3,4-dihydro-2H-acridin-1-one.
What is the SMILES notation for 9-amino-7-methoxy-3,4-dihydro-2H-acridin-1-one?
The canonical SMILES for 9-amino-7-methoxy-3,4-dihydro-2H-acridin-1-one is COc1ccc2nc3c(c(N)c2c1)C(=O)CCC3.
What is the InChIKey of 9-amino-7-methoxy-3,4-dihydro-2H-acridin-1-one?
The InChIKey is UMCAERASQBVGHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O2/c1-18-8-5-6-10-9(7-8)14(15)13-11(16-10)3-2-4-12(13)17/h5-7H,2-4H2,1H3,(H2,15,16).
What are the key properties of 9-amino-7-methoxy-3,4-dihydro-2H-acridin-1-one?
9-amino-7-methoxy-3,4-dihydro-2H-acridin-1-one has a molecular weight of 242.28 g/mol, XLogP of 2.34, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-amino-7-methoxy-3,4-dihydro-2H-acridin-1-one is sourced from PubChem (CID 15043979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).