About 1,7,10-triazaspiro[4.5]deca-1,3-diene
1,7,10-triazaspiro[4.5]deca-1,3-diene (PubChem CID 150440673) has the molecular formula C7H11N3
and a molecular weight of 137.19 g/mol. Its IUPAC name is 1,7,10-triazaspiro[4.5]deca-1,3-diene.
Molecular Properties
| Compound Name | 1,7,10-triazaspiro[4.5]deca-1,3-diene |
| PubChem CID | 150440673 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 1,7,10-triazaspiro[4.5]deca-1,3-diene |
| SMILES | C1=CC2(CNCCN2)N=C1 |
| InChI | InChI=1S/C7H11N3/c1-2-7(9-3-1)6-8-4-5-10-7/h1-3,8,10H,4-6H2 |
| InChIKey | HLRYHYGBAPVGRH-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,7,10-triazaspiro[4.5]deca-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7,10-triazaspiro[4.5]deca-1,3-diene?
The IUPAC name of 1,7,10-triazaspiro[4.5]deca-1,3-diene (CID 150440673) is 1,7,10-triazaspiro[4.5]deca-1,3-diene.
What is the SMILES notation for 1,7,10-triazaspiro[4.5]deca-1,3-diene?
The canonical SMILES for 1,7,10-triazaspiro[4.5]deca-1,3-diene is C1=CC2(CNCCN2)N=C1.
What is the InChIKey of 1,7,10-triazaspiro[4.5]deca-1,3-diene?
The InChIKey is HLRYHYGBAPVGRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3/c1-2-7(9-3-1)6-8-4-5-10-7/h1-3,8,10H,4-6H2.
What are the key properties of 1,7,10-triazaspiro[4.5]deca-1,3-diene?
1,7,10-triazaspiro[4.5]deca-1,3-diene has a molecular weight of 137.19 g/mol, XLogP of -0.48, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7,10-triazaspiro[4.5]deca-1,3-diene is sourced from PubChem (CID 150440673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).