C14H11N5O — CID 15044082
7-amino-11-phenyl-1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),6,10-tetraen-5-one (PubChem CID 15044082) has the molecular formula C14H11N5O and a molecular weight of 265.28 g/mol. Its IUPAC name is 7-amino-11-phenyl-1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),6,10-tetraen-5-one.
| Compound Name | 7-amino-11-phenyl-1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),6,10-tetraen-5-one |
|---|---|
| PubChem CID | 15044082 |
| Molecular Formula | C14H11N5O |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 7-amino-11-phenyl-1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),6,10-tetraen-5-one |
| SMILES | Nc1nc(=O)c2cnn3c2n1CC=C3c1ccccc1 |
| InChI | InChI=1S/C14H11N5O/c15-14-17-12(20)10-8-16-19-11(6-7-18(14)13(10)19)9-4-2-1-3-5-9/h1-6,8H,7H2,(H2,15,17,20) |
| InChIKey | AFRXXRQTYLNRSL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |