About 3-phenyl-2,6-dihydro-1H-pyrimidine-2-carbonitrile
3-phenyl-2,6-dihydro-1H-pyrimidine-2-carbonitrile (PubChem CID 150441075) has the molecular formula C11H11N3
and a molecular weight of 185.23 g/mol. Its IUPAC name is 3-phenyl-2,6-dihydro-1H-pyrimidine-2-carbonitrile.
Molecular Properties
| Compound Name | 3-phenyl-2,6-dihydro-1H-pyrimidine-2-carbonitrile |
| PubChem CID | 150441075 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 3-phenyl-2,6-dihydro-1H-pyrimidine-2-carbonitrile |
| SMILES | N#CC1NCC=CN1c1ccccc1 |
| InChI | InChI=1S/C11H11N3/c12-9-11-13-7-4-8-14(11)10-5-2-1-3-6-10/h1-6,8,11,13H,7H2 |
| InChIKey | HLUBEUOVFKRRIR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-phenyl-2,6-dihydro-1H-pyrimidine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-2,6-dihydro-1H-pyrimidine-2-carbonitrile?
The IUPAC name of 3-phenyl-2,6-dihydro-1H-pyrimidine-2-carbonitrile (CID 150441075) is 3-phenyl-2,6-dihydro-1H-pyrimidine-2-carbonitrile.
What is the SMILES notation for 3-phenyl-2,6-dihydro-1H-pyrimidine-2-carbonitrile?
The canonical SMILES for 3-phenyl-2,6-dihydro-1H-pyrimidine-2-carbonitrile is N#CC1NCC=CN1c1ccccc1.
What is the InChIKey of 3-phenyl-2,6-dihydro-1H-pyrimidine-2-carbonitrile?
The InChIKey is HLUBEUOVFKRRIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3/c12-9-11-13-7-4-8-14(11)10-5-2-1-3-6-10/h1-6,8,11,13H,7H2.
What are the key properties of 3-phenyl-2,6-dihydro-1H-pyrimidine-2-carbonitrile?
3-phenyl-2,6-dihydro-1H-pyrimidine-2-carbonitrile has a molecular weight of 185.23 g/mol, XLogP of 1.46, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-2,6-dihydro-1H-pyrimidine-2-carbonitrile is sourced from PubChem (CID 150441075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).