C23H25ClN2O7S — CID 150441349
2-(3-butyl-2,5-dioxoimidazolidin-1-yl)-3-(5-chloro-2-phenylphenyl)sulfonyl-2-hydroxybutanoic acid (PubChem CID 150441349) has the molecular formula C23H25ClN2O7S and a molecular weight of 508.98 g/mol. Its IUPAC name is 2-(3-butyl-2,5-dioxoimidazolidin-1-yl)-3-(5-chloro-2-phenylphenyl)sulfonyl-2-hydroxybutanoic acid.
| Compound Name | 2-(3-butyl-2,5-dioxoimidazolidin-1-yl)-3-(5-chloro-2-phenylphenyl)sulfonyl-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 150441349 |
| Molecular Formula | C23H25ClN2O7S |
| Molecular Weight | 508.98 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 2-(3-butyl-2,5-dioxoimidazolidin-1-yl)-3-(5-chloro-2-phenylphenyl)sulfonyl-2-hydroxybutanoic acid |
| SMILES | CCCCN1CC(=O)N(C(O)(C(=O)O)C(C)S(=O)(=O)c2cc(Cl)ccc2-c2ccccc2)C1=O |
| InChI | InChI=1S/C23H25ClN2O7S/c1-3-4-12-25-14-20(27)26(22(25)30)23(31,21(28)29)15(2)34(32,33)19-13-17(24)10-11-18(19)16-8-6-5-7-9-16/h5-11,13,15,31H,3-4,12,14H2,1-2H3,(H,28,29) |
| InChIKey | HLVJPIWOAXQHBM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.98 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|