About 2-hydroxy-1,2-bis[4-(trifluoromethyl)phenyl]ethanone
2-hydroxy-1,2-bis[4-(trifluoromethyl)phenyl]ethanone (PubChem CID 15044210) has the molecular formula C16H10F6O2
and a molecular weight of 348.24 g/mol. Its IUPAC name is 2-hydroxy-1,2-bis[4-(trifluoromethyl)phenyl]ethanone.
Molecular Properties
| Compound Name | 2-hydroxy-1,2-bis[4-(trifluoromethyl)phenyl]ethanone |
| PubChem CID | 15044210 |
| Molecular Formula | C16H10F6O2 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 2-hydroxy-1,2-bis[4-(trifluoromethyl)phenyl]ethanone |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)C(O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H10F6O2/c17-15(18,19)11-5-1-9(2-6-11)13(23)14(24)10-3-7-12(8-4-10)16(20,21)22/h1-8,13,23H |
| InChIKey | YXRXAFBHYVJYJW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-hydroxy-1,2-bis[4-(trifluoromethyl)phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-1,2-bis[4-(trifluoromethyl)phenyl]ethanone?
The IUPAC name of 2-hydroxy-1,2-bis[4-(trifluoromethyl)phenyl]ethanone (CID 15044210) is 2-hydroxy-1,2-bis[4-(trifluoromethyl)phenyl]ethanone.
What is the SMILES notation for 2-hydroxy-1,2-bis[4-(trifluoromethyl)phenyl]ethanone?
The canonical SMILES for 2-hydroxy-1,2-bis[4-(trifluoromethyl)phenyl]ethanone is O=C(c1ccc(C(F)(F)F)cc1)C(O)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of 2-hydroxy-1,2-bis[4-(trifluoromethyl)phenyl]ethanone?
The InChIKey is YXRXAFBHYVJYJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10F6O2/c17-15(18,19)11-5-1-9(2-6-11)13(23)14(24)10-3-7-12(8-4-10)16(20,21)22/h1-8,13,23H.
What are the key properties of 2-hydroxy-1,2-bis[4-(trifluoromethyl)phenyl]ethanone?
2-hydroxy-1,2-bis[4-(trifluoromethyl)phenyl]ethanone has a molecular weight of 348.24 g/mol, XLogP of 4.64, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-1,2-bis[4-(trifluoromethyl)phenyl]ethanone is sourced from PubChem (CID 15044210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).