About 1-(4,5-dimethyl-1-propan-2-ylpyrazol-3-yl)-N,N-dimethylmethanamine
1-(4,5-dimethyl-1-propan-2-ylpyrazol-3-yl)-N,N-dimethylmethanamine (PubChem CID 150443374) has the molecular formula C11H21N3
and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-(4,5-dimethyl-1-propan-2-ylpyrazol-3-yl)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-(4,5-dimethyl-1-propan-2-ylpyrazol-3-yl)-N,N-dimethylmethanamine |
| PubChem CID | 150443374 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 1-(4,5-dimethyl-1-propan-2-ylpyrazol-3-yl)-N,N-dimethylmethanamine |
| SMILES | Cc1c(CN(C)C)nn(C(C)C)c1C |
| InChI | InChI=1S/C11H21N3/c1-8(2)14-10(4)9(3)11(12-14)7-13(5)6/h8H,7H2,1-6H3 |
| InChIKey | HMFYSTHJCXPNBE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4,5-dimethyl-1-propan-2-ylpyrazol-3-yl)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dimethyl-1-propan-2-ylpyrazol-3-yl)-N,N-dimethylmethanamine?
The IUPAC name of 1-(4,5-dimethyl-1-propan-2-ylpyrazol-3-yl)-N,N-dimethylmethanamine (CID 150443374) is 1-(4,5-dimethyl-1-propan-2-ylpyrazol-3-yl)-N,N-dimethylmethanamine.
What is the SMILES notation for 1-(4,5-dimethyl-1-propan-2-ylpyrazol-3-yl)-N,N-dimethylmethanamine?
The canonical SMILES for 1-(4,5-dimethyl-1-propan-2-ylpyrazol-3-yl)-N,N-dimethylmethanamine is Cc1c(CN(C)C)nn(C(C)C)c1C.
What is the InChIKey of 1-(4,5-dimethyl-1-propan-2-ylpyrazol-3-yl)-N,N-dimethylmethanamine?
The InChIKey is HMFYSTHJCXPNBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3/c1-8(2)14-10(4)9(3)11(12-14)7-13(5)6/h8H,7H2,1-6H3.
What are the key properties of 1-(4,5-dimethyl-1-propan-2-ylpyrazol-3-yl)-N,N-dimethylmethanamine?
1-(4,5-dimethyl-1-propan-2-ylpyrazol-3-yl)-N,N-dimethylmethanamine has a molecular weight of 195.31 g/mol, XLogP of 2.14, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dimethyl-1-propan-2-ylpyrazol-3-yl)-N,N-dimethylmethanamine is sourced from PubChem (CID 150443374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).