About 1-ethenoxy-9H-xanthene
1-ethenoxy-9H-xanthene (PubChem CID 150445419) has the molecular formula C15H12O2
and a molecular weight of 224.26 g/mol. Its IUPAC name is 1-ethenoxy-9H-xanthene.
Molecular Properties
| Compound Name | 1-ethenoxy-9H-xanthene |
| PubChem CID | 150445419 |
| Molecular Formula | C15H12O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 1-ethenoxy-9H-xanthene |
| SMILES | C=COc1cccc2c1Cc1ccccc1O2 |
| InChI | InChI=1S/C15H12O2/c1-2-16-14-8-5-9-15-12(14)10-11-6-3-4-7-13(11)17-15/h2-9H,1,10H2 |
| InChIKey | HMQRHOPLUYRZOS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenoxy-9H-xanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenoxy-9H-xanthene?
The IUPAC name of 1-ethenoxy-9H-xanthene (CID 150445419) is 1-ethenoxy-9H-xanthene.
What is the SMILES notation for 1-ethenoxy-9H-xanthene?
The canonical SMILES for 1-ethenoxy-9H-xanthene is C=COc1cccc2c1Cc1ccccc1O2.
What is the InChIKey of 1-ethenoxy-9H-xanthene?
The InChIKey is HMQRHOPLUYRZOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O2/c1-2-16-14-8-5-9-15-12(14)10-11-6-3-4-7-13(11)17-15/h2-9H,1,10H2.
What are the key properties of 1-ethenoxy-9H-xanthene?
1-ethenoxy-9H-xanthene has a molecular weight of 224.26 g/mol, XLogP of 3.91, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenoxy-9H-xanthene is sourced from PubChem (CID 150445419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).