About 4-but-3-enylphenol
4-but-3-enylphenol (PubChem CID 15044572) has the molecular formula C10H12O
and a molecular weight of 148.20 g/mol. Its IUPAC name is 4-but-3-enylphenol.
Molecular Properties
| Compound Name | 4-but-3-enylphenol |
| PubChem CID | 15044572 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 4-but-3-enylphenol |
| SMILES | C=CCCc1ccc(O)cc1 |
| InChI | InChI=1S/C10H12O/c1-2-3-4-9-5-7-10(11)8-6-9/h2,5-8,11H,1,3-4H2 |
| InChIKey | IAZKGRRJAULWNS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-but-3-enylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-3-enylphenol?
The IUPAC name of 4-but-3-enylphenol (CID 15044572) is 4-but-3-enylphenol.
What is the SMILES notation for 4-but-3-enylphenol?
The canonical SMILES for 4-but-3-enylphenol is C=CCCc1ccc(O)cc1.
What is the InChIKey of 4-but-3-enylphenol?
The InChIKey is IAZKGRRJAULWNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O/c1-2-3-4-9-5-7-10(11)8-6-9/h2,5-8,11H,1,3-4H2.
What are the key properties of 4-but-3-enylphenol?
4-but-3-enylphenol has a molecular weight of 148.20 g/mol, XLogP of 2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-3-enylphenol is sourced from PubChem (CID 15044572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).