C6H3F11 — CID 15044579
4-(difluoromethyl)-1,1,1,2,2,3,5,5,5-nonafluoropentane (PubChem CID 15044579) has the molecular formula C6H3F11 and a molecular weight of 284.07 g/mol. Its IUPAC name is 4-(difluoromethyl)-1,1,1,2,2,3,5,5,5-nonafluoropentane.
| Compound Name | 4-(difluoromethyl)-1,1,1,2,2,3,5,5,5-nonafluoropentane |
|---|---|
| PubChem CID | 15044579 |
| Molecular Formula | C6H3F11 |
| Molecular Weight | 284.07 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 4-(difluoromethyl)-1,1,1,2,2,3,5,5,5-nonafluoropentane |
| SMILES | FC(F)C(C(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H3F11/c7-2(4(10,11)6(15,16)17)1(3(8)9)5(12,13)14/h1-3H |
| InChIKey | FCJGGCHINXUPCJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.07 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|