About 2-(difluoromethyl)-1,1,1,4,4,4-hexafluorobutane
2-(difluoromethyl)-1,1,1,4,4,4-hexafluorobutane (PubChem CID 15044585) has the molecular formula C5H4F8
and a molecular weight of 216.07 g/mol. Its IUPAC name is 2-(difluoromethyl)-1,1,1,4,4,4-hexafluorobutane.
Analyze 2-(difluoromethyl)-1,1,1,4,4,4-hexafluorobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-1,1,1,4,4,4-hexafluorobutane?
The IUPAC name of 2-(difluoromethyl)-1,1,1,4,4,4-hexafluorobutane (CID 15044585) is 2-(difluoromethyl)-1,1,1,4,4,4-hexafluorobutane.
What is the SMILES notation for 2-(difluoromethyl)-1,1,1,4,4,4-hexafluorobutane?
The canonical SMILES for 2-(difluoromethyl)-1,1,1,4,4,4-hexafluorobutane is FC(F)C(CC(F)(F)F)C(F)(F)F.
What is the InChIKey of 2-(difluoromethyl)-1,1,1,4,4,4-hexafluorobutane?
The InChIKey is DIUYDLCYPXPTSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4F8/c6-3(7)2(5(11,12)13)1-4(8,9)10/h2-3H,1H2.
What are the key properties of 2-(difluoromethyl)-1,1,1,4,4,4-hexafluorobutane?
2-(difluoromethyl)-1,1,1,4,4,4-hexafluorobutane has a molecular weight of 216.07 g/mol, XLogP of 3.38, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-1,1,1,4,4,4-hexafluorobutane is sourced from PubChem (CID 15044585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).