C6H4F10 — CID 15044602
2-(difluoromethyl)-1,1,1,3,3,4,4,5-octafluoropentane (PubChem CID 15044602) has the molecular formula C6H4F10 and a molecular weight of 266.08 g/mol. Its IUPAC name is 2-(difluoromethyl)-1,1,1,3,3,4,4,5-octafluoropentane.
| Compound Name | 2-(difluoromethyl)-1,1,1,3,3,4,4,5-octafluoropentane |
|---|---|
| PubChem CID | 15044602 |
| Molecular Formula | C6H4F10 |
| Molecular Weight | 266.08 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | 2-(difluoromethyl)-1,1,1,3,3,4,4,5-octafluoropentane |
| SMILES | FCC(F)(F)C(F)(F)C(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H4F10/c7-1-4(10,11)5(12,13)2(3(8)9)6(14,15)16/h2-3H,1H2 |
| InChIKey | UCYTZLJQXGAXEY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.08 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|