C7H7F9 — CID 15044622
2-(difluoromethyl)-1,1,1,3,3,4,4-heptafluorohexane (PubChem CID 15044622) has the molecular formula C7H7F9 and a molecular weight of 262.12 g/mol. Its IUPAC name is 2-(difluoromethyl)-1,1,1,3,3,4,4-heptafluorohexane.
| Compound Name | 2-(difluoromethyl)-1,1,1,3,3,4,4-heptafluorohexane |
|---|---|
| PubChem CID | 15044622 |
| Molecular Formula | C7H7F9 |
| Molecular Weight | 262.12 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 2-(difluoromethyl)-1,1,1,3,3,4,4-heptafluorohexane |
| SMILES | CCC(F)(F)C(F)(F)C(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H7F9/c1-2-5(10,11)6(12,13)3(4(8)9)7(14,15)16/h3-4H,2H2,1H3 |
| InChIKey | QEYIUDXHDPFOOV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.12 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|