C7H9F7 — CID 15044623
2-(difluoromethyl)-1,1,1,3,3-pentafluorohexane (PubChem CID 15044623) has the molecular formula C7H9F7 and a molecular weight of 226.13 g/mol. Its IUPAC name is 2-(difluoromethyl)-1,1,1,3,3-pentafluorohexane.
| Compound Name | 2-(difluoromethyl)-1,1,1,3,3-pentafluorohexane |
|---|---|
| PubChem CID | 15044623 |
| Molecular Formula | C7H9F7 |
| Molecular Weight | 226.13 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 2-(difluoromethyl)-1,1,1,3,3-pentafluorohexane |
| SMILES | CCCC(F)(F)C(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H9F7/c1-2-3-6(10,11)4(5(8)9)7(12,13)14/h4-5H,2-3H2,1H3 |
| InChIKey | UZLWPNVHSYWMBZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.13 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |