C11H17NO2 — CID 15045109
2-[(4S,6R)-2,2-dimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]acetonitrile (PubChem CID 15045109) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-[(4S,6R)-2,2-dimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]acetonitrile.
| Compound Name | 2-[(4S,6R)-2,2-dimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]acetonitrile |
|---|---|
| PubChem CID | 15045109 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 2-[(4S,6R)-2,2-dimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]acetonitrile |
| SMILES | C=CC[C@@H]1C[C@H](CC#N)OC(C)(C)O1 |
| InChI | InChI=1S/C11H17NO2/c1-4-5-9-8-10(6-7-12)14-11(2,3)13-9/h4,9-10H,1,5-6,8H2,2-3H3/t9-,10+/m1/s1 |
| InChIKey | KOXRGLSAKBHDON-ZJUUUORDSA-N |
| XLogP | 2.39 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|