About 2-(7-prop-2-enyl-6,10-dioxaspiro[4.5]decan-9-yl)acetonitrile
2-(7-prop-2-enyl-6,10-dioxaspiro[4.5]decan-9-yl)acetonitrile (PubChem CID 15045128) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-(7-prop-2-enyl-6,10-dioxaspiro[4.5]decan-9-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(7-prop-2-enyl-6,10-dioxaspiro[4.5]decan-9-yl)acetonitrile |
| PubChem CID | 15045128 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-(7-prop-2-enyl-6,10-dioxaspiro[4.5]decan-9-yl)acetonitrile |
| SMILES | C=CCC1CC(CC#N)OC2(CCCC2)O1 |
| InChI | InChI=1S/C13H19NO2/c1-2-5-11-10-12(6-9-14)16-13(15-11)7-3-4-8-13/h2,11-12H,1,3-8,10H2 |
| InChIKey | JMIQLDBHSDUZRW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(7-prop-2-enyl-6,10-dioxaspiro[4.5]decan-9-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-prop-2-enyl-6,10-dioxaspiro[4.5]decan-9-yl)acetonitrile?
The IUPAC name of 2-(7-prop-2-enyl-6,10-dioxaspiro[4.5]decan-9-yl)acetonitrile (CID 15045128) is 2-(7-prop-2-enyl-6,10-dioxaspiro[4.5]decan-9-yl)acetonitrile.
What is the SMILES notation for 2-(7-prop-2-enyl-6,10-dioxaspiro[4.5]decan-9-yl)acetonitrile?
The canonical SMILES for 2-(7-prop-2-enyl-6,10-dioxaspiro[4.5]decan-9-yl)acetonitrile is C=CCC1CC(CC#N)OC2(CCCC2)O1.
What is the InChIKey of 2-(7-prop-2-enyl-6,10-dioxaspiro[4.5]decan-9-yl)acetonitrile?
The InChIKey is JMIQLDBHSDUZRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2/c1-2-5-11-10-12(6-9-14)16-13(15-11)7-3-4-8-13/h2,11-12H,1,3-8,10H2.
What are the key properties of 2-(7-prop-2-enyl-6,10-dioxaspiro[4.5]decan-9-yl)acetonitrile?
2-(7-prop-2-enyl-6,10-dioxaspiro[4.5]decan-9-yl)acetonitrile has a molecular weight of 221.30 g/mol, XLogP of 2.92, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-prop-2-enyl-6,10-dioxaspiro[4.5]decan-9-yl)acetonitrile is sourced from PubChem (CID 15045128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).