C28H36N4O4 — CID 15045296
(E)-4-(4-imidazol-1-ylphenyl)-N-[3-[methyl-[2-(3,4,5-trimethoxyphenyl)ethyl]amino]propyl]but-3-enamide (PubChem CID 15045296) has the molecular formula C28H36N4O4 and a molecular weight of 492.62 g/mol. Its IUPAC name is (E)-4-(4-imidazol-1-ylphenyl)-N-[3-[methyl-[2-(3,4,5-trimethoxyphenyl)ethyl]amino]propyl]but-3-enamide.
| Compound Name | (E)-4-(4-imidazol-1-ylphenyl)-N-[3-[methyl-[2-(3,4,5-trimethoxyphenyl)ethyl]amino]propyl]but-3-enamide |
|---|---|
| PubChem CID | 15045296 |
| Molecular Formula | C28H36N4O4 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | (E)-4-(4-imidazol-1-ylphenyl)-N-[3-[methyl-[2-(3,4,5-trimethoxyphenyl)ethyl]amino]propyl]but-3-enamide |
| SMILES | COc1cc(CCN(C)CCCNC(=O)C/C=C/c2ccc(-n3ccnc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C28H36N4O4/c1-31(17-13-23-19-25(34-2)28(36-4)26(20-23)35-3)16-6-14-30-27(33)8-5-7-22-9-11-24(12-10-22)32-18-15-29-21-32/h5,7,9-12,15,18-21H,6,8,13-14,16-17H2,1-4H3,(H,30,33)/b7-5+ |
| InChIKey | IIKYLJQCRAGBCE-FNORWQNLSA-N |
| XLogP | 3.98 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|