C7H10F6N2 — CID 150456202
1,2,2,3,3,5-hexafluoro-4-propan-2-ylpiperazine (PubChem CID 150456202) has the molecular formula C7H10F6N2 and a molecular weight of 236.16 g/mol. Its IUPAC name is 1,2,2,3,3,5-hexafluoro-4-propan-2-ylpiperazine.
| Compound Name | 1,2,2,3,3,5-hexafluoro-4-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 150456202 |
| Molecular Formula | C7H10F6N2 |
| Molecular Weight | 236.16 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 1,2,2,3,3,5-hexafluoro-4-propan-2-ylpiperazine |
| SMILES | CC(C)N1C(F)CN(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C7H10F6N2/c1-4(2)15-5(8)3-14(13)6(9,10)7(15,11)12/h4-5H,3H2,1-2H3 |
| InChIKey | HOVKVTHJOJOCEW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.16 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|