C14H14N6O2 — CID 15045640
(1E)-2-amino-N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)anilino]-2-oxoethanimidoyl cyanide (PubChem CID 15045640) has the molecular formula C14H14N6O2 and a molecular weight of 298.31 g/mol. Its IUPAC name is (1E)-2-amino-N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)anilino]-2-oxoethanimidoyl cyanide.
| Compound Name | (1E)-2-amino-N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)anilino]-2-oxoethanimidoyl cyanide |
|---|---|
| PubChem CID | 15045640 |
| Molecular Formula | C14H14N6O2 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (1E)-2-amino-N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)anilino]-2-oxoethanimidoyl cyanide |
| SMILES | CC1CC(=O)NN=C1c1ccc(N/N=C(\C#N)C(N)=O)cc1 |
| InChI | InChI=1S/C14H14N6O2/c1-8-6-12(21)19-20-13(8)9-2-4-10(5-3-9)17-18-11(7-15)14(16)22/h2-5,8,17H,6H2,1H3,(H2,16,22)(H,19,21)/b18-11+ |
| InChIKey | LUJCZDRCGSZQQE-WOJGMQOQSA-N |
| XLogP | 0.32 |
| TPSA | 132.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|