C20H36O2 — CID 150457207
5-(butoxymethyl)-2-(heptoxymethyl)-5-methylcyclohexa-1,3-diene (PubChem CID 150457207) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is 5-(butoxymethyl)-2-(heptoxymethyl)-5-methylcyclohexa-1,3-diene.
| Compound Name | 5-(butoxymethyl)-2-(heptoxymethyl)-5-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 150457207 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | 5-(butoxymethyl)-2-(heptoxymethyl)-5-methylcyclohexa-1,3-diene |
| SMILES | CCCCCCCOCC1=CCC(C)(COCCCC)C=C1 |
| InChI | InChI=1S/C20H36O2/c1-4-6-8-9-10-16-21-17-19-11-13-20(3,14-12-19)18-22-15-7-5-2/h11-13H,4-10,14-18H2,1-3H3 |
| InChIKey | HPAOCVPEUMZHSV-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|