About 1-(4,6-dimethyl-6-morpholin-4-yl-5-sulfanylcyclohexa-2,4-dien-1-yl)propan-1-one
1-(4,6-dimethyl-6-morpholin-4-yl-5-sulfanylcyclohexa-2,4-dien-1-yl)propan-1-one (PubChem CID 150458684) has the molecular formula C15H23NO2S
and a molecular weight of 281.42 g/mol. Its IUPAC name is 1-(4,6-dimethyl-6-morpholin-4-yl-5-sulfanylcyclohexa-2,4-dien-1-yl)propan-1-one.
Molecular Properties
| Compound Name | 1-(4,6-dimethyl-6-morpholin-4-yl-5-sulfanylcyclohexa-2,4-dien-1-yl)propan-1-one |
| PubChem CID | 150458684 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 1-(4,6-dimethyl-6-morpholin-4-yl-5-sulfanylcyclohexa-2,4-dien-1-yl)propan-1-one |
| SMILES | CCC(=O)C1C=CC(C)=C(S)C1(C)N1CCOCC1 |
| InChI | InChI=1S/C15H23NO2S/c1-4-13(17)12-6-5-11(2)14(19)15(12,3)16-7-9-18-10-8-16/h5-6,12,19H,4,7-10H2,1-3H3 |
| InChIKey | HPIAYCTTWSCQAW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,6-dimethyl-6-morpholin-4-yl-5-sulfanylcyclohexa-2,4-dien-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,6-dimethyl-6-morpholin-4-yl-5-sulfanylcyclohexa-2,4-dien-1-yl)propan-1-one?
The IUPAC name of 1-(4,6-dimethyl-6-morpholin-4-yl-5-sulfanylcyclohexa-2,4-dien-1-yl)propan-1-one (CID 150458684) is 1-(4,6-dimethyl-6-morpholin-4-yl-5-sulfanylcyclohexa-2,4-dien-1-yl)propan-1-one.
What is the SMILES notation for 1-(4,6-dimethyl-6-morpholin-4-yl-5-sulfanylcyclohexa-2,4-dien-1-yl)propan-1-one?
The canonical SMILES for 1-(4,6-dimethyl-6-morpholin-4-yl-5-sulfanylcyclohexa-2,4-dien-1-yl)propan-1-one is CCC(=O)C1C=CC(C)=C(S)C1(C)N1CCOCC1.
What is the InChIKey of 1-(4,6-dimethyl-6-morpholin-4-yl-5-sulfanylcyclohexa-2,4-dien-1-yl)propan-1-one?
The InChIKey is HPIAYCTTWSCQAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO2S/c1-4-13(17)12-6-5-11(2)14(19)15(12,3)16-7-9-18-10-8-16/h5-6,12,19H,4,7-10H2,1-3H3.
What are the key properties of 1-(4,6-dimethyl-6-morpholin-4-yl-5-sulfanylcyclohexa-2,4-dien-1-yl)propan-1-one?
1-(4,6-dimethyl-6-morpholin-4-yl-5-sulfanylcyclohexa-2,4-dien-1-yl)propan-1-one has a molecular weight of 281.42 g/mol, XLogP of 2.45, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,6-dimethyl-6-morpholin-4-yl-5-sulfanylcyclohexa-2,4-dien-1-yl)propan-1-one is sourced from PubChem (CID 150458684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).