About 2-ethyl-4,6-dimethyl-2H-pyridin-3-one
2-ethyl-4,6-dimethyl-2H-pyridin-3-one (PubChem CID 150459104) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 2-ethyl-4,6-dimethyl-2H-pyridin-3-one.
Molecular Properties
| Compound Name | 2-ethyl-4,6-dimethyl-2H-pyridin-3-one |
| PubChem CID | 150459104 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 2-ethyl-4,6-dimethyl-2H-pyridin-3-one |
| SMILES | CCC1N=C(C)C=C(C)C1=O |
| InChI | InChI=1S/C9H13NO/c1-4-8-9(11)6(2)5-7(3)10-8/h5,8H,4H2,1-3H3 |
| InChIKey | HPKHCADWNUHPEO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-4,6-dimethyl-2H-pyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4,6-dimethyl-2H-pyridin-3-one?
The IUPAC name of 2-ethyl-4,6-dimethyl-2H-pyridin-3-one (CID 150459104) is 2-ethyl-4,6-dimethyl-2H-pyridin-3-one.
What is the SMILES notation for 2-ethyl-4,6-dimethyl-2H-pyridin-3-one?
The canonical SMILES for 2-ethyl-4,6-dimethyl-2H-pyridin-3-one is CCC1N=C(C)C=C(C)C1=O.
What is the InChIKey of 2-ethyl-4,6-dimethyl-2H-pyridin-3-one?
The InChIKey is HPKHCADWNUHPEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-4-8-9(11)6(2)5-7(3)10-8/h5,8H,4H2,1-3H3.
What are the key properties of 2-ethyl-4,6-dimethyl-2H-pyridin-3-one?
2-ethyl-4,6-dimethyl-2H-pyridin-3-one has a molecular weight of 151.21 g/mol, XLogP of 1.75, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4,6-dimethyl-2H-pyridin-3-one is sourced from PubChem (CID 150459104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).