C26H28O6 — CID 15046013
dimethyl 13,18-dimethoxynonacyclo[12.6.0.02,6.04,11.05,9.07,20.010,17.012,16.015,19]icosa-1(20),10-diene-3,8-dicarboxylate (PubChem CID 15046013) has the molecular formula C26H28O6 and a molecular weight of 436.50 g/mol. Its IUPAC name is dimethyl 13,18-dimethoxynonacyclo[12.6.0.02,6.04,11.05,9.07,20.010,17.012,16.015,19]icosa-1(20),10-diene-3,8-dicarboxylate.
| Compound Name | dimethyl 13,18-dimethoxynonacyclo[12.6.0.02,6.04,11.05,9.07,20.010,17.012,16.015,19]icosa-1(20),10-diene-3,8-dicarboxylate |
|---|---|
| PubChem CID | 15046013 |
| Molecular Formula | C26H28O6 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | dimethyl 13,18-dimethoxynonacyclo[12.6.0.02,6.04,11.05,9.07,20.010,17.012,16.015,19]icosa-1(20),10-diene-3,8-dicarboxylate |
| SMILES | COC(=O)C1C2C3=C4C5C(OC)C6C7=C(C8C(OC)C3C5C86)C1C1C7C(C(=O)OC)C4C21 |
| InChI | InChI=1S/C26H28O6/c1-29-23-17-7-9-13-5-6-12(21(11(5)7)25(27)31-3)8-10(14(6)22(13)26(28)32-4)20-16(18(8)23)15(17)19(9)24(20)30-2/h5-6,11-24H,1-4H3 |
| InChIKey | ZBKJLQGLZXAARM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|