C25H24O6 — CID 15046014
dimethyl 13-methoxy-18-oxononacyclo[12.6.0.02,6.04,11.05,9.07,20.010,17.012,16.015,19]icosa-1(20),10-diene-3,8-dicarboxylate (PubChem CID 15046014) has the molecular formula C25H24O6 and a molecular weight of 420.46 g/mol. Its IUPAC name is dimethyl 13-methoxy-18-oxononacyclo[12.6.0.02,6.04,11.05,9.07,20.010,17.012,16.015,19]icosa-1(20),10-diene-3,8-dicarboxylate.
| Compound Name | dimethyl 13-methoxy-18-oxononacyclo[12.6.0.02,6.04,11.05,9.07,20.010,17.012,16.015,19]icosa-1(20),10-diene-3,8-dicarboxylate |
|---|---|
| PubChem CID | 15046014 |
| Molecular Formula | C25H24O6 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | dimethyl 13-methoxy-18-oxononacyclo[12.6.0.02,6.04,11.05,9.07,20.010,17.012,16.015,19]icosa-1(20),10-diene-3,8-dicarboxylate |
| SMILES | COC(=O)C1C2C3=C4C5C(OC)C6C7=C(C8C(=O)C3C5C86)C1C1C7C(C(=O)OC)C4C21 |
| InChI | InChI=1S/C25H24O6/c1-29-23-18-8-6-10-4-5-11(20(10)24(27)30-2)7-9(13(5)21(12(4)8)25(28)31-3)19(23)15-14(18)16(6)22(26)17(7)15/h4-5,10-21,23H,1-3H3 |
| InChIKey | XOUQOROHIWKLAO-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|