C9H11F6NO — CID 150460401
3-(1,1,2,4,4,4-hexafluorobutyl)-1-methylpyrrolidin-2-one (PubChem CID 150460401) has the molecular formula C9H11F6NO and a molecular weight of 263.18 g/mol. Its IUPAC name is 3-(1,1,2,4,4,4-hexafluorobutyl)-1-methylpyrrolidin-2-one.
| Compound Name | 3-(1,1,2,4,4,4-hexafluorobutyl)-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 150460401 |
| Molecular Formula | C9H11F6NO |
| Molecular Weight | 263.18 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 3-(1,1,2,4,4,4-hexafluorobutyl)-1-methylpyrrolidin-2-one |
| SMILES | CN1CCC(C(F)(F)C(F)CC(F)(F)F)C1=O |
| InChI | InChI=1S/C9H11F6NO/c1-16-3-2-5(7(16)17)9(14,15)6(10)4-8(11,12)13/h5-6H,2-4H2,1H3 |
| InChIKey | HPQYAQJCGZIFSP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.18 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |