C45H50N7O6P — CID 150460859
N-[8-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-9-[2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyethyl]purin-6-yl]benzamide (PubChem CID 150460859) has the molecular formula C45H50N7O6P and a molecular weight of 815.91 g/mol. Its IUPAC name is N-[8-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-9-[2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyethyl]purin-6-yl]benzamide.
| Compound Name | N-[8-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-9-[2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyethyl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 150460859 |
| Molecular Formula | C45H50N7O6P |
| Molecular Weight | 815.91 g/mol |
| Exact Mass | 815.36 |
| IUPAC Name | N-[8-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-9-[2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyethyl]purin-6-yl]benzamide |
| SMILES | COc1ccc(C(OCc2nc3c(NC(=O)c4ccccc4)ncnc3n2CCOP(OCCC#N)N(C(C)C)C(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C45H50N7O6P/c1-32(2)52(33(3)4)59(57-28-13-26-46)58-29-27-51-40(49-41-42(47-31-48-43(41)51)50-44(53)34-14-9-7-10-15-34)30-56-45(35-16-11-8-12-17-35,36-18-22-38(54-5)23-19-36)37-20-24-39(55-6)25-21-37/h7-12,14-25,31-33H,13,27-30H2,1-6H3,(H,47,48,50,53) |
| InChIKey | HPTDWECLCAJUHR-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 145.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.91 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|