C21H24O14 — CID 150462657
heptamethyl bicyclo[2.2.1]hept-5-ene-1,2,2,3,4,5,6-heptacarboxylate (PubChem CID 150462657) has the molecular formula C21H24O14 and a molecular weight of 500.41 g/mol. Its IUPAC name is heptamethyl bicyclo[2.2.1]hept-5-ene-1,2,2,3,4,5,6-heptacarboxylate.
| Compound Name | heptamethyl bicyclo[2.2.1]hept-5-ene-1,2,2,3,4,5,6-heptacarboxylate |
|---|---|
| PubChem CID | 150462657 |
| Molecular Formula | C21H24O14 |
| Molecular Weight | 500.41 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | heptamethyl bicyclo[2.2.1]hept-5-ene-1,2,2,3,4,5,6-heptacarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(C(=O)OC)CC1(C(=O)OC)C(C(=O)OC)C2(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C21H24O14/c1-29-12(22)9-10(13(23)30-2)20(16(26)33-5)8-19(9,15(25)32-4)11(14(24)31-3)21(20,17(27)34-6)18(28)35-7/h11H,8H2,1-7H3 |
| InChIKey | HQCKWWADCFXKTJ-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 184.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.41 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|