About ethanesulfonate;tetrabutylazanium
ethanesulfonate;tetrabutylazanium (PubChem CID 15046319) has the molecular formula C18H41NO3S
and a molecular weight of 351.60 g/mol. Its IUPAC name is ethanesulfonate;tetrabutylazanium.
Molecular Properties
| Compound Name | ethanesulfonate;tetrabutylazanium |
| PubChem CID | 15046319 |
| Molecular Formula | C18H41NO3S |
| Molecular Weight | 351.60 g/mol |
| Exact Mass | 351.28 |
| IUPAC Name | ethanesulfonate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.CCS(=O)(=O)[O-] |
| InChI | InChI=1S/C16H36N.C2H6O3S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-2-6(3,4)5/h5-16H2,1-4H3;2H2,1H3,(H,3,4,5)/q+1;/p-1 |
| InChIKey | JKKHUNQXHNZFFL-UHFFFAOYSA-M |
| XLogP | 4.56 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.60 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze ethanesulfonate;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanesulfonate;tetrabutylazanium?
The IUPAC name of ethanesulfonate;tetrabutylazanium (CID 15046319) is ethanesulfonate;tetrabutylazanium.
What is the SMILES notation for ethanesulfonate;tetrabutylazanium?
The canonical SMILES for ethanesulfonate;tetrabutylazanium is CCCC[N+](CCCC)(CCCC)CCCC.CCS(=O)(=O)[O-].
What is the InChIKey of ethanesulfonate;tetrabutylazanium?
The InChIKey is JKKHUNQXHNZFFL-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.C2H6O3S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-2-6(3,4)5/h5-16H2,1-4H3;2H2,1H3,(H,3,4,5)/q+1;/p-1.
What are the key properties of ethanesulfonate;tetrabutylazanium?
ethanesulfonate;tetrabutylazanium has a molecular weight of 351.60 g/mol, XLogP of 4.56, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanesulfonate;tetrabutylazanium is sourced from PubChem (CID 15046319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).