C26H27F2N5O4 — CID 150463260
[[amino-[2-(3,3-difluoropyrrolidine-1-carbonyl)-1-[[4-(ethylcarbamoyl)phenyl]methyl]indol-6-yl]methylidene]amino] acetate (PubChem CID 150463260) has the molecular formula C26H27F2N5O4 and a molecular weight of 511.53 g/mol. Its IUPAC name is [[amino-[2-(3,3-difluoropyrrolidine-1-carbonyl)-1-[[4-(ethylcarbamoyl)phenyl]methyl]indol-6-yl]methylidene]amino] acetate.
| Compound Name | [[amino-[2-(3,3-difluoropyrrolidine-1-carbonyl)-1-[[4-(ethylcarbamoyl)phenyl]methyl]indol-6-yl]methylidene]amino] acetate |
|---|---|
| PubChem CID | 150463260 |
| Molecular Formula | C26H27F2N5O4 |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | [[amino-[2-(3,3-difluoropyrrolidine-1-carbonyl)-1-[[4-(ethylcarbamoyl)phenyl]methyl]indol-6-yl]methylidene]amino] acetate |
| SMILES | CCNC(=O)c1ccc(Cn2c(C(=O)N3CCC(F)(F)C3)cc3ccc(C(N)=NOC(C)=O)cc32)cc1 |
| InChI | InChI=1S/C26H27F2N5O4/c1-3-30-24(35)18-6-4-17(5-7-18)14-33-21-13-20(23(29)31-37-16(2)34)9-8-19(21)12-22(33)25(36)32-11-10-26(27,28)15-32/h4-9,12-13H,3,10-11,14-15H2,1-2H3,(H2,29,31)(H,30,35) |
| InChIKey | HQFLKYOHGUCMIT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 119.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|