About (2-acetamidophenyl) hypochlorite
(2-acetamidophenyl) hypochlorite (PubChem CID 150463309) has the molecular formula C8H8ClNO2
and a molecular weight of 185.61 g/mol. Its IUPAC name is (2-acetamidophenyl) hypochlorite.
Molecular Properties
| Compound Name | (2-acetamidophenyl) hypochlorite |
| PubChem CID | 150463309 |
| Molecular Formula | C8H8ClNO2 |
| Molecular Weight | 185.61 g/mol |
| Exact Mass | 185.02 |
| IUPAC Name | (2-acetamidophenyl) hypochlorite |
| SMILES | CC(=O)Nc1ccccc1OCl |
| InChI | InChI=1S/C8H8ClNO2/c1-6(11)10-7-4-2-3-5-8(7)12-9/h2-5H,1H3,(H,10,11) |
| InChIKey | HQFSRZXGYXOEEE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.61 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-acetamidophenyl) hypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetamidophenyl) hypochlorite?
The IUPAC name of (2-acetamidophenyl) hypochlorite (CID 150463309) is (2-acetamidophenyl) hypochlorite.
What is the SMILES notation for (2-acetamidophenyl) hypochlorite?
The canonical SMILES for (2-acetamidophenyl) hypochlorite is CC(=O)Nc1ccccc1OCl.
What is the InChIKey of (2-acetamidophenyl) hypochlorite?
The InChIKey is HQFSRZXGYXOEEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClNO2/c1-6(11)10-7-4-2-3-5-8(7)12-9/h2-5H,1H3,(H,10,11).
What are the key properties of (2-acetamidophenyl) hypochlorite?
(2-acetamidophenyl) hypochlorite has a molecular weight of 185.61 g/mol, XLogP of 2.18, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetamidophenyl) hypochlorite is sourced from PubChem (CID 150463309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).