C23H27F3N8OSi — CID 150464406
2-[[3-[(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]-5-(2H-tetrazol-5-yl)pyrazolo[5,4-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 150464406) has the molecular formula C23H27F3N8OSi and a molecular weight of 516.60 g/mol. Its IUPAC name is 2-[[3-[(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]-5-(2H-tetrazol-5-yl)pyrazolo[5,4-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-[(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]-5-(2H-tetrazol-5-yl)pyrazolo[5,4-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 150464406 |
| Molecular Formula | C23H27F3N8OSi |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | 2-[[3-[(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]-5-(2H-tetrazol-5-yl)pyrazolo[5,4-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1nc(N2C[C@@H](F)C[C@@H]2c2cc(F)ccc2F)c2cc(-c3nn[nH]n3)cnc21 |
| InChI | InChI=1S/C23H27F3N8OSi/c1-36(2,3)7-6-35-13-34-22-18(8-14(11-27-22)21-28-31-32-29-21)23(30-34)33-12-16(25)10-20(33)17-9-15(24)4-5-19(17)26/h4-5,8-9,11,16,20H,6-7,10,12-13H2,1-3H3,(H,28,29,31,32)/t16-,20+/m0/s1 |
| InChIKey | HQLOUXLMGVJOSG-OXJNMPFZSA-N |
| XLogP | 4.49 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|