C19H21ClFNO3 — CID 150464749
2-[(2-chlorophenyl)methyl]-4-(5-fluoro-2-hydroxyphenyl)-2-hydroxy-4-methylpentanamide (PubChem CID 150464749) has the molecular formula C19H21ClFNO3 and a molecular weight of 365.83 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-4-(5-fluoro-2-hydroxyphenyl)-2-hydroxy-4-methylpentanamide.
| Compound Name | 2-[(2-chlorophenyl)methyl]-4-(5-fluoro-2-hydroxyphenyl)-2-hydroxy-4-methylpentanamide |
|---|---|
| PubChem CID | 150464749 |
| Molecular Formula | C19H21ClFNO3 |
| Molecular Weight | 365.83 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-4-(5-fluoro-2-hydroxyphenyl)-2-hydroxy-4-methylpentanamide |
| SMILES | CC(C)(CC(O)(Cc1ccccc1Cl)C(N)=O)c1cc(F)ccc1O |
| InChI | InChI=1S/C19H21ClFNO3/c1-18(2,14-9-13(21)7-8-16(14)23)11-19(25,17(22)24)10-12-5-3-4-6-15(12)20/h3-9,23,25H,10-11H2,1-2H3,(H2,22,24) |
| InChIKey | HQNNXWSYVKEEMG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.83 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |