C22H22F2N6 — CID 150465763
4-(5-cyclopropyl-1H-pyrazol-3-yl)-7-fluoro-2-[(1S)-1-(4-fluorophenyl)ethyl]imino-1,3-dihydroquinazolin-4-amine (PubChem CID 150465763) has the molecular formula C22H22F2N6 and a molecular weight of 408.46 g/mol. Its IUPAC name is 4-(5-cyclopropyl-1H-pyrazol-3-yl)-7-fluoro-2-[(1S)-1-(4-fluorophenyl)ethyl]imino-1,3-dihydroquinazolin-4-amine.
| Compound Name | 4-(5-cyclopropyl-1H-pyrazol-3-yl)-7-fluoro-2-[(1S)-1-(4-fluorophenyl)ethyl]imino-1,3-dihydroquinazolin-4-amine |
|---|---|
| PubChem CID | 150465763 |
| Molecular Formula | C22H22F2N6 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 4-(5-cyclopropyl-1H-pyrazol-3-yl)-7-fluoro-2-[(1S)-1-(4-fluorophenyl)ethyl]imino-1,3-dihydroquinazolin-4-amine |
| SMILES | C[C@H](/N=C1\Nc2cc(F)ccc2C(N)(c2cc(C3CC3)[nH]n2)N1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H22F2N6/c1-12(13-4-6-15(23)7-5-13)26-21-27-19-10-16(24)8-9-17(19)22(25,28-21)20-11-18(29-30-20)14-2-3-14/h4-12,14H,2-3,25H2,1H3,(H,29,30)(H2,26,27,28)/t12-,22?/m0/s1 |
| InChIKey | HQSVGQINNVBACI-BJDAYTSDSA-N |
| XLogP | 3.86 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|