About [4-(benzenesulfinyl)-4,4-difluorobutyl]benzene
[4-(benzenesulfinyl)-4,4-difluorobutyl]benzene (PubChem CID 150465846) has the molecular formula C16H16F2OS
and a molecular weight of 294.37 g/mol. Its IUPAC name is [4-(benzenesulfinyl)-4,4-difluorobutyl]benzene.
Molecular Properties
| Compound Name | [4-(benzenesulfinyl)-4,4-difluorobutyl]benzene |
| PubChem CID | 150465846 |
| Molecular Formula | C16H16F2OS |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | [4-(benzenesulfinyl)-4,4-difluorobutyl]benzene |
| SMILES | O=S(c1ccccc1)C(F)(F)CCCc1ccccc1 |
| InChI | InChI=1S/C16H16F2OS/c17-16(18,20(19)15-11-5-2-6-12-15)13-7-10-14-8-3-1-4-9-14/h1-6,8-9,11-12H,7,10,13H2 |
| InChIKey | HQTIUUSIPLZRMB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [4-(benzenesulfinyl)-4,4-difluorobutyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(benzenesulfinyl)-4,4-difluorobutyl]benzene?
The IUPAC name of [4-(benzenesulfinyl)-4,4-difluorobutyl]benzene (CID 150465846) is [4-(benzenesulfinyl)-4,4-difluorobutyl]benzene.
What is the SMILES notation for [4-(benzenesulfinyl)-4,4-difluorobutyl]benzene?
The canonical SMILES for [4-(benzenesulfinyl)-4,4-difluorobutyl]benzene is O=S(c1ccccc1)C(F)(F)CCCc1ccccc1.
What is the InChIKey of [4-(benzenesulfinyl)-4,4-difluorobutyl]benzene?
The InChIKey is HQTIUUSIPLZRMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16F2OS/c17-16(18,20(19)15-11-5-2-6-12-15)13-7-10-14-8-3-1-4-9-14/h1-6,8-9,11-12H,7,10,13H2.
What are the key properties of [4-(benzenesulfinyl)-4,4-difluorobutyl]benzene?
[4-(benzenesulfinyl)-4,4-difluorobutyl]benzene has a molecular weight of 294.37 g/mol, XLogP of 4.41, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(benzenesulfinyl)-4,4-difluorobutyl]benzene is sourced from PubChem (CID 150465846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).