About pyrrolidin-3-yl acetate
pyrrolidin-3-yl acetate (PubChem CID 15046662) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is pyrrolidin-3-yl acetate.
Molecular Properties
| Compound Name | pyrrolidin-3-yl acetate |
| PubChem CID | 15046662 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | pyrrolidin-3-yl acetate |
| SMILES | CC(=O)OC1CCNC1 |
| InChI | InChI=1S/C6H11NO2/c1-5(8)9-6-2-3-7-4-6/h6-7H,2-4H2,1H3 |
| InChIKey | AKCMCFPQVUTWFW-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrrolidin-3-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidin-3-yl acetate?
The IUPAC name of pyrrolidin-3-yl acetate (CID 15046662) is pyrrolidin-3-yl acetate.
What is the SMILES notation for pyrrolidin-3-yl acetate?
The canonical SMILES for pyrrolidin-3-yl acetate is CC(=O)OC1CCNC1.
What is the InChIKey of pyrrolidin-3-yl acetate?
The InChIKey is AKCMCFPQVUTWFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2/c1-5(8)9-6-2-3-7-4-6/h6-7H,2-4H2,1H3.
What are the key properties of pyrrolidin-3-yl acetate?
pyrrolidin-3-yl acetate has a molecular weight of 129.16 g/mol, XLogP of -0.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidin-3-yl acetate is sourced from PubChem (CID 15046662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).