C20H29FS — CID 150469282
(8S,9R,10S,13R,14S)-9-fluoro-10-methyl-13-(methylsulfanylmethyl)-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 150469282) has the molecular formula C20H29FS and a molecular weight of 320.52 g/mol. Its IUPAC name is (8S,9R,10S,13R,14S)-9-fluoro-10-methyl-13-(methylsulfanylmethyl)-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9R,10S,13R,14S)-9-fluoro-10-methyl-13-(methylsulfanylmethyl)-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 150469282 |
| Molecular Formula | C20H29FS |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (8S,9R,10S,13R,14S)-9-fluoro-10-methyl-13-(methylsulfanylmethyl)-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | CSC[C@@]12CCC[C@H]1[C@@H]1CCC3=CCC=C[C@]3(C)[C@@]1(F)CC2 |
| InChI | InChI=1S/C20H29FS/c1-18-10-4-3-6-15(18)8-9-17-16-7-5-11-19(16,14-22-2)12-13-20(17,18)21/h4,6,10,16-17H,3,5,7-9,11-14H2,1-2H3/t16-,17-,18-,19-,20+/m0/s1 |
| InChIKey | HRLITJFBNHKLCH-VYJAJWGXSA-N |
| XLogP | 5.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|